About 2-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide
2-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 153409356) has the molecular formula C7H11N3O3
and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide.
Molecular Properties
| Compound Name | 2-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
| PubChem CID | 153409356 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 2-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | NC(=O)C1(O)CCC2CN1C(=O)N2 |
| InChI | InChI=1S/C7H11N3O3/c8-5(11)7(13)2-1-4-3-10(7)6(12)9-4/h4,13H,1-3H2,(H2,8,11)(H,9,12) |
| InChIKey | AIXLPVBEHYRJMX-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide?
The IUPAC name of 2-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide (CID 153409356) is 2-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide.
What is the SMILES notation for 2-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide?
The canonical SMILES for 2-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide is NC(=O)C1(O)CCC2CN1C(=O)N2.
What is the InChIKey of 2-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide?
The InChIKey is AIXLPVBEHYRJMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O3/c8-5(11)7(13)2-1-4-3-10(7)6(12)9-4/h4,13H,1-3H2,(H2,8,11)(H,9,12).
What are the key properties of 2-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide?
2-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide has a molecular weight of 185.18 g/mol, XLogP of -1.65, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide is sourced from PubChem (CID 153409356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).