About 5'-bromo-1'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carbonitrile
5'-bromo-1'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carbonitrile (PubChem CID 153409382) has the molecular formula C12H9BrN2O
and a molecular weight of 277.12 g/mol. Its IUPAC name is 5'-bromo-1'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carbonitrile.
Molecular Properties
| Compound Name | 5'-bromo-1'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carbonitrile |
| PubChem CID | 153409382 |
| Molecular Formula | C12H9BrN2O |
| Molecular Weight | 277.12 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 5'-bromo-1'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carbonitrile |
| SMILES | CN1C(=O)C2(CC2C#N)c2cc(Br)ccc21 |
| InChI | InChI=1S/C12H9BrN2O/c1-15-10-3-2-8(13)4-9(10)12(11(15)16)5-7(12)6-14/h2-4,7H,5H2,1H3 |
| InChIKey | FNBXAMDRAHDBAF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.12 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5'-bromo-1'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5'-bromo-1'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carbonitrile?
The IUPAC name of 5'-bromo-1'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carbonitrile (CID 153409382) is 5'-bromo-1'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carbonitrile.
What is the SMILES notation for 5'-bromo-1'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carbonitrile?
The canonical SMILES for 5'-bromo-1'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carbonitrile is CN1C(=O)C2(CC2C#N)c2cc(Br)ccc21.
What is the InChIKey of 5'-bromo-1'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carbonitrile?
The InChIKey is FNBXAMDRAHDBAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrN2O/c1-15-10-3-2-8(13)4-9(10)12(11(15)16)5-7(12)6-14/h2-4,7H,5H2,1H3.
What are the key properties of 5'-bromo-1'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carbonitrile?
5'-bromo-1'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carbonitrile has a molecular weight of 277.12 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5'-bromo-1'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carbonitrile is sourced from PubChem (CID 153409382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).