C10H14N4 — CID 153409627
1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene (PubChem CID 153409627) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene.
| Compound Name | 1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
|---|---|
| PubChem CID | 153409627 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene |
| SMILES | c1ncc2c(n1)N1CCNCC1CC2 |
| InChI | InChI=1S/C10H14N4/c1-2-9-6-11-3-4-14(9)10-8(1)5-12-7-13-10/h5,7,9,11H,1-4,6H2 |
| InChIKey | RGGWECJLJREZDK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |