About 1-[4-(1,1-difluoropropan-2-ylamino)cyclohexyl]cyclobutane-1-carboxamide
1-[4-(1,1-difluoropropan-2-ylamino)cyclohexyl]cyclobutane-1-carboxamide (PubChem CID 153410122) has the molecular formula C14H24F2N2O
and a molecular weight of 274.35 g/mol. Its IUPAC name is 1-[4-(1,1-difluoropropan-2-ylamino)cyclohexyl]cyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | 1-[4-(1,1-difluoropropan-2-ylamino)cyclohexyl]cyclobutane-1-carboxamide |
| PubChem CID | 153410122 |
| Molecular Formula | C14H24F2N2O |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1-[4-(1,1-difluoropropan-2-ylamino)cyclohexyl]cyclobutane-1-carboxamide |
| SMILES | CC(NC1CCC(C2(C(N)=O)CCC2)CC1)C(F)F |
| InChI | InChI=1S/C14H24F2N2O/c1-9(12(15)16)18-11-5-3-10(4-6-11)14(13(17)19)7-2-8-14/h9-12,18H,2-8H2,1H3,(H2,17,19) |
| InChIKey | WGHGWWUVFFWLOJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-(1,1-difluoropropan-2-ylamino)cyclohexyl]cyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1,1-difluoropropan-2-ylamino)cyclohexyl]cyclobutane-1-carboxamide?
The IUPAC name of 1-[4-(1,1-difluoropropan-2-ylamino)cyclohexyl]cyclobutane-1-carboxamide (CID 153410122) is 1-[4-(1,1-difluoropropan-2-ylamino)cyclohexyl]cyclobutane-1-carboxamide.
What is the SMILES notation for 1-[4-(1,1-difluoropropan-2-ylamino)cyclohexyl]cyclobutane-1-carboxamide?
The canonical SMILES for 1-[4-(1,1-difluoropropan-2-ylamino)cyclohexyl]cyclobutane-1-carboxamide is CC(NC1CCC(C2(C(N)=O)CCC2)CC1)C(F)F.
What is the InChIKey of 1-[4-(1,1-difluoropropan-2-ylamino)cyclohexyl]cyclobutane-1-carboxamide?
The InChIKey is WGHGWWUVFFWLOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24F2N2O/c1-9(12(15)16)18-11-5-3-10(4-6-11)14(13(17)19)7-2-8-14/h9-12,18H,2-8H2,1H3,(H2,17,19).
What are the key properties of 1-[4-(1,1-difluoropropan-2-ylamino)cyclohexyl]cyclobutane-1-carboxamide?
1-[4-(1,1-difluoropropan-2-ylamino)cyclohexyl]cyclobutane-1-carboxamide has a molecular weight of 274.35 g/mol, XLogP of 2.44, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1,1-difluoropropan-2-ylamino)cyclohexyl]cyclobutane-1-carboxamide is sourced from PubChem (CID 153410122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).