C30H27N3O2 — CID 153410207
N-[(4-methoxyphenyl)methyl]-1-[2-(4-methoxyphenyl)phenyl]-5-phenylpyrazol-3-amine (PubChem CID 153410207) has the molecular formula C30H27N3O2 and a molecular weight of 461.57 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-1-[2-(4-methoxyphenyl)phenyl]-5-phenylpyrazol-3-amine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-1-[2-(4-methoxyphenyl)phenyl]-5-phenylpyrazol-3-amine |
|---|---|
| PubChem CID | 153410207 |
| Molecular Formula | C30H27N3O2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-1-[2-(4-methoxyphenyl)phenyl]-5-phenylpyrazol-3-amine |
| SMILES | COc1ccc(CNc2cc(-c3ccccc3)n(-c3ccccc3-c3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C30H27N3O2/c1-34-25-16-12-22(13-17-25)21-31-30-20-29(24-8-4-3-5-9-24)33(32-30)28-11-7-6-10-27(28)23-14-18-26(35-2)19-15-23/h3-20H,21H2,1-2H3,(H,31,32) |
| InChIKey | KIYMLRFMHDTCPW-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |