About N-benzyl-2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N-propan-2-ylacetamide
N-benzyl-2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N-propan-2-ylacetamide (PubChem CID 15341057) has the molecular formula C24H34N2O3S
and a molecular weight of 430.61 g/mol. Its IUPAC name is N-benzyl-2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | N-benzyl-2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N-propan-2-ylacetamide |
| PubChem CID | 15341057 |
| Molecular Formula | C24H34N2O3S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | N-benzyl-2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N-propan-2-ylacetamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NS(=O)(=O)CC(=O)N(Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C24H34N2O3S/c1-17(2)21-13-10-14-22(18(3)4)24(21)25-30(28,29)16-23(27)26(19(5)6)15-20-11-8-7-9-12-20/h7-14,17-19,25H,15-16H2,1-6H3 |
| InChIKey | PSBVMZBAKZHHIG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N-propan-2-ylacetamide?
The IUPAC name of N-benzyl-2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N-propan-2-ylacetamide (CID 15341057) is N-benzyl-2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N-propan-2-ylacetamide.
What is the SMILES notation for N-benzyl-2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N-propan-2-ylacetamide?
The canonical SMILES for N-benzyl-2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N-propan-2-ylacetamide is CC(C)c1cccc(C(C)C)c1NS(=O)(=O)CC(=O)N(Cc1ccccc1)C(C)C.
What is the InChIKey of N-benzyl-2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N-propan-2-ylacetamide?
The InChIKey is PSBVMZBAKZHHIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34N2O3S/c1-17(2)21-13-10-14-22(18(3)4)24(21)25-30(28,29)16-23(27)26(19(5)6)15-20-11-8-7-9-12-20/h7-14,17-19,25H,15-16H2,1-6H3.
What are the key properties of N-benzyl-2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N-propan-2-ylacetamide?
N-benzyl-2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N-propan-2-ylacetamide has a molecular weight of 430.61 g/mol, XLogP of 5.11, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N-propan-2-ylacetamide is sourced from PubChem (CID 15341057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).