About S-hexyl 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]ethanethioate
S-hexyl 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]ethanethioate (PubChem CID 15341059) has the molecular formula C20H33NO3S2
and a molecular weight of 399.62 g/mol. Its IUPAC name is S-hexyl 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]ethanethioate.
Molecular Properties
| Compound Name | S-hexyl 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]ethanethioate |
| PubChem CID | 15341059 |
| Molecular Formula | C20H33NO3S2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | S-hexyl 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]ethanethioate |
| SMILES | CCCCCCSC(=O)CS(=O)(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C20H33NO3S2/c1-6-7-8-9-13-25-19(22)14-26(23,24)21-20-17(15(2)3)11-10-12-18(20)16(4)5/h10-12,15-16,21H,6-9,13-14H2,1-5H3 |
| InChIKey | ZDTPXBFTEVACLU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-hexyl 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-hexyl 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]ethanethioate?
The IUPAC name of S-hexyl 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]ethanethioate (CID 15341059) is S-hexyl 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]ethanethioate.
What is the SMILES notation for S-hexyl 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]ethanethioate?
The canonical SMILES for S-hexyl 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]ethanethioate is CCCCCCSC(=O)CS(=O)(=O)Nc1c(C(C)C)cccc1C(C)C.
What is the InChIKey of S-hexyl 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]ethanethioate?
The InChIKey is ZDTPXBFTEVACLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33NO3S2/c1-6-7-8-9-13-25-19(22)14-26(23,24)21-20-17(15(2)3)11-10-12-18(20)16(4)5/h10-12,15-16,21H,6-9,13-14H2,1-5H3.
What are the key properties of S-hexyl 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]ethanethioate?
S-hexyl 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]ethanethioate has a molecular weight of 399.62 g/mol, XLogP of 5.52, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-hexyl 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]ethanethioate is sourced from PubChem (CID 15341059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).