C18H18ClFN2O2S — CID 153412129
3-[1-[(4-chloro-2-fluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-3-oxo-2-(thiolan-1-ylidene)propanenitrile (PubChem CID 153412129) has the molecular formula C18H18ClFN2O2S and a molecular weight of 380.87 g/mol. Its IUPAC name is 3-[1-[(4-chloro-2-fluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-3-oxo-2-(thiolan-1-ylidene)propanenitrile.
| Compound Name | 3-[1-[(4-chloro-2-fluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-3-oxo-2-(thiolan-1-ylidene)propanenitrile |
|---|---|
| PubChem CID | 153412129 |
| Molecular Formula | C18H18ClFN2O2S |
| Molecular Weight | 380.87 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 3-[1-[(4-chloro-2-fluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-3-oxo-2-(thiolan-1-ylidene)propanenitrile |
| SMILES | N#CC(C(=O)C1CCC(=O)N1Cc1ccc(Cl)cc1F)=S1CCCC1 |
| InChI | InChI=1S/C18H18ClFN2O2S/c19-13-4-3-12(14(20)9-13)11-22-15(5-6-17(22)23)18(24)16(10-21)25-7-1-2-8-25/h3-4,9,15H,1-2,5-8,11H2 |
| InChIKey | XMVUOPISSUKKTF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.87 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|