About 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methoxy]acetic acid
2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methoxy]acetic acid (PubChem CID 153412228) has the molecular formula C11H19F2NO3
and a molecular weight of 251.27 g/mol. Its IUPAC name is 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methoxy]acetic acid |
| PubChem CID | 153412228 |
| Molecular Formula | C11H19F2NO3 |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methoxy]acetic acid |
| SMILES | CC(C)(C)N1CC(COCC(=O)O)C(F)(F)C1 |
| InChI | InChI=1S/C11H19F2NO3/c1-10(2,3)14-4-8(11(12,13)7-14)5-17-6-9(15)16/h8H,4-7H2,1-3H3,(H,15,16) |
| InChIKey | SNYBNYAJGZZHLI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methoxy]acetic acid?
The IUPAC name of 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methoxy]acetic acid (CID 153412228) is 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methoxy]acetic acid.
What is the SMILES notation for 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methoxy]acetic acid?
The canonical SMILES for 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methoxy]acetic acid is CC(C)(C)N1CC(COCC(=O)O)C(F)(F)C1.
What is the InChIKey of 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methoxy]acetic acid?
The InChIKey is SNYBNYAJGZZHLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2NO3/c1-10(2,3)14-4-8(11(12,13)7-14)5-17-6-9(15)16/h8H,4-7H2,1-3H3,(H,15,16).
What are the key properties of 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methoxy]acetic acid?
2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methoxy]acetic acid has a molecular weight of 251.27 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methoxy]acetic acid is sourced from PubChem (CID 153412228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).