About 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methyl-methylamino]acetic acid
2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methyl-methylamino]acetic acid (PubChem CID 153412235) has the molecular formula C12H22F2N2O2
and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methyl-methylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methyl-methylamino]acetic acid |
| PubChem CID | 153412235 |
| Molecular Formula | C12H22F2N2O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)CC1CN(C(C)(C)C)CC1(F)F |
| InChI | InChI=1S/C12H22F2N2O2/c1-11(2,3)16-6-9(12(13,14)8-16)5-15(4)7-10(17)18/h9H,5-8H2,1-4H3,(H,17,18) |
| InChIKey | JHHJVQAFYUDKDY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methyl-methylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methyl-methylamino]acetic acid?
The IUPAC name of 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methyl-methylamino]acetic acid (CID 153412235) is 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methyl-methylamino]acetic acid.
What is the SMILES notation for 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methyl-methylamino]acetic acid?
The canonical SMILES for 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methyl-methylamino]acetic acid is CN(CC(=O)O)CC1CN(C(C)(C)C)CC1(F)F.
What is the InChIKey of 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methyl-methylamino]acetic acid?
The InChIKey is JHHJVQAFYUDKDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F2N2O2/c1-11(2,3)16-6-9(12(13,14)8-16)5-15(4)7-10(17)18/h9H,5-8H2,1-4H3,(H,17,18).
What are the key properties of 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methyl-methylamino]acetic acid?
2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methyl-methylamino]acetic acid has a molecular weight of 264.32 g/mol, XLogP of 1.37, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-tert-butyl-4,4-difluoropyrrolidin-3-yl)methyl-methylamino]acetic acid is sourced from PubChem (CID 153412235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).