C49H38N4O3Pt — CID 153412877
9-(4-tert-butyl-2-pyridinyl)-2-[3-[4-(4-methyl-2,6-diphenoxyphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153412877) has the molecular formula C49H38N4O3Pt and a molecular weight of 925.95 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[3-[4-(4-methyl-2,6-diphenoxyphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-[4-(4-methyl-2,6-diphenoxyphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153412877 |
| Molecular Formula | C49H38N4O3Pt |
| Molecular Weight | 925.95 g/mol |
| Exact Mass | 925.26 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-[4-(4-methyl-2,6-diphenoxyphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum(2+) |
| SMILES | Cc1cc(Oc2ccccc2)c(-c2cnn(-c3[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)C)ccn4)ccc3)c2)c(Oc2ccccc2)c1.[Pt+2] |
| InChI | InChI=1S/C49H38N4O3.Pt/c1-33-26-45(55-37-15-7-5-8-16-37)48(46(27-33)56-38-17-9-6-10-18-38)34-31-51-52(32-34)36-14-13-19-39(29-36)54-40-22-23-42-41-20-11-12-21-43(41)53(44(42)30-40)47-28-35(24-25-50-47)49(2,3)4;/h5-28,31-32H,1-4H3;/q-2;+2 |
| InChIKey | HHAYUUIVBVCYGS-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 63.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.95 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|