C41H38N4OPtS — CID 153412979
2-[3-[4-(2,6-dibutylphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-9-(4-methylsulfanyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153412979) has the molecular formula C41H38N4OPtS and a molecular weight of 829.93 g/mol. Its IUPAC name is 2-[3-[4-(2,6-dibutylphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-9-(4-methylsulfanyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 2-[3-[4-(2,6-dibutylphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-9-(4-methylsulfanyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153412979 |
| Molecular Formula | C41H38N4OPtS |
| Molecular Weight | 829.93 g/mol |
| Exact Mass | 829.24 |
| IUPAC Name | 2-[3-[4-(2,6-dibutylphenyl)pyrazol-1-yl]benzene-2-id-1-yl]oxy-9-(4-methylsulfanyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) |
| SMILES | CCCCc1cccc(CCCC)c1-c1cnn(-c2[c-]c(Oc3[c-]c4c(cc3)c3ccccc3n4-c3cc(SC)ccn3)ccc2)c1.[Pt+2] |
| InChI | InChI=1S/C41H38N4OS.Pt/c1-4-6-12-29-14-10-15-30(13-7-5-2)41(29)31-27-43-44(28-31)32-16-11-17-33(24-32)46-34-20-21-37-36-18-8-9-19-38(36)45(39(37)25-34)40-26-35(47-3)22-23-42-40;/h8-11,14-23,26-28H,4-7,12-13H2,1-3H3;/q-2;+2 |
| InChIKey | YVZLJADFSBILNT-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.93 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|