C17H21FO4 — CID 15341428
[4-[(1E,3Z)-4-fluoro-3-methyl-5-oxopenta-1,3-dienyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] acetate (PubChem CID 15341428) has the molecular formula C17H21FO4 and a molecular weight of 308.35 g/mol. Its IUPAC name is [4-[(1E,3Z)-4-fluoro-3-methyl-5-oxopenta-1,3-dienyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] acetate.
| Compound Name | [4-[(1E,3Z)-4-fluoro-3-methyl-5-oxopenta-1,3-dienyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 15341428 |
| Molecular Formula | C17H21FO4 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [4-[(1E,3Z)-4-fluoro-3-methyl-5-oxopenta-1,3-dienyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)OC1CC(C)(C)C(/C=C/C(C)=C(\F)C=O)=C(C)C1=O |
| InChI | InChI=1S/C17H21FO4/c1-10(14(18)9-19)6-7-13-11(2)16(21)15(22-12(3)20)8-17(13,4)5/h6-7,9,15H,8H2,1-5H3/b7-6+,14-10- |
| InChIKey | MMZSFTWVCIXUCF-FKEISFMISA-N |
| XLogP | 3.23 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|