About 3,5-ditert-butyl-4-(4-methylphenyl)-1-propan-2-ylpyrazole;platinum
3,5-ditert-butyl-4-(4-methylphenyl)-1-propan-2-ylpyrazole;platinum (PubChem CID 153415279) has the molecular formula C21H32N2Pt
and a molecular weight of 507.58 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-(4-methylphenyl)-1-propan-2-ylpyrazole;platinum.
Molecular Properties
| Compound Name | 3,5-ditert-butyl-4-(4-methylphenyl)-1-propan-2-ylpyrazole;platinum |
| PubChem CID | 153415279 |
| Molecular Formula | C21H32N2Pt |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 3,5-ditert-butyl-4-(4-methylphenyl)-1-propan-2-ylpyrazole;platinum |
| SMILES | Cc1ccc(-c2c(C(C)(C)C)nn(C(C)C)c2C(C)(C)C)cc1.[Pt] |
| InChI | InChI=1S/C21H32N2.Pt/c1-14(2)23-19(21(7,8)9)17(18(22-23)20(4,5)6)16-12-10-15(3)11-13-16;/h10-14H,1-9H3; |
| InChIKey | CNFAWFKEERWWOP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-ditert-butyl-4-(4-methylphenyl)-1-propan-2-ylpyrazole;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-ditert-butyl-4-(4-methylphenyl)-1-propan-2-ylpyrazole;platinum?
The IUPAC name of 3,5-ditert-butyl-4-(4-methylphenyl)-1-propan-2-ylpyrazole;platinum (CID 153415279) is 3,5-ditert-butyl-4-(4-methylphenyl)-1-propan-2-ylpyrazole;platinum.
What is the SMILES notation for 3,5-ditert-butyl-4-(4-methylphenyl)-1-propan-2-ylpyrazole;platinum?
The canonical SMILES for 3,5-ditert-butyl-4-(4-methylphenyl)-1-propan-2-ylpyrazole;platinum is Cc1ccc(-c2c(C(C)(C)C)nn(C(C)C)c2C(C)(C)C)cc1.[Pt].
What is the InChIKey of 3,5-ditert-butyl-4-(4-methylphenyl)-1-propan-2-ylpyrazole;platinum?
The InChIKey is CNFAWFKEERWWOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32N2.Pt/c1-14(2)23-19(21(7,8)9)17(18(22-23)20(4,5)6)16-12-10-15(3)11-13-16;/h10-14H,1-9H3;.
What are the key properties of 3,5-ditert-butyl-4-(4-methylphenyl)-1-propan-2-ylpyrazole;platinum?
3,5-ditert-butyl-4-(4-methylphenyl)-1-propan-2-ylpyrazole;platinum has a molecular weight of 507.58 g/mol, XLogP of 6.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-ditert-butyl-4-(4-methylphenyl)-1-propan-2-ylpyrazole;platinum is sourced from PubChem (CID 153415279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).