C24H28FN3O — CID 153415795
4-[(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]-1-(2,3,5,6-tetradeuterio-4-fluorophenyl)butan-1-one (PubChem CID 153415795) has the molecular formula C24H28FN3O and a molecular weight of 397.53 g/mol. Its IUPAC name is 4-[(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]-1-(2,3,5,6-tetradeuterio-4-fluorophenyl)butan-1-one.
| Compound Name | 4-[(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]-1-(2,3,5,6-tetradeuterio-4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 153415795 |
| Molecular Formula | C24H28FN3O |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 4-[(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]-1-(2,3,5,6-tetradeuterio-4-fluorophenyl)butan-1-one |
| SMILES | [2H]c1c([2H])c(C(=O)CCCN2CC[C@H]3[C@@H](C2)c2cccc4c2N3CCN4C)c([2H])c([2H])c1F |
| InChI | InChI=1S/C24H28FN3O/c1-26-14-15-28-21-11-13-27(16-20(21)19-4-2-5-22(26)24(19)28)12-3-6-23(29)17-7-9-18(25)10-8-17/h2,4-5,7-10,20-21H,3,6,11-16H2,1H3/t20-,21-/m0/s1/i7D,8D,9D,10D |
| InChIKey | HOIIHACBCFLJET-NSOGIYDGSA-N |
| XLogP | 3.92 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |