C14H14F3NO6S — CID 15341587
[(3R,3aR)-3-(methoxymethyl)-1-oxo-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-7-yl] trifluoromethanesulfonate (PubChem CID 15341587) has the molecular formula C14H14F3NO6S and a molecular weight of 381.33 g/mol. Its IUPAC name is [(3R,3aR)-3-(methoxymethyl)-1-oxo-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-7-yl] trifluoromethanesulfonate.
| Compound Name | [(3R,3aR)-3-(methoxymethyl)-1-oxo-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 15341587 |
| Molecular Formula | C14H14F3NO6S |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | [(3R,3aR)-3-(methoxymethyl)-1-oxo-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-7-yl] trifluoromethanesulfonate |
| SMILES | COC[C@@H]1OC(=O)N2c3ccc(OS(=O)(=O)C(F)(F)F)cc3CC[C@H]12 |
| InChI | InChI=1S/C14H14F3NO6S/c1-22-7-12-11-4-2-8-6-9(24-25(20,21)14(15,16)17)3-5-10(8)18(11)13(19)23-12/h3,5-6,11-12H,2,4,7H2,1H3/t11-,12+/m1/s1 |
| InChIKey | XQOOPRGVEOEERH-NEPJUHHUSA-N |
| XLogP | 2.20 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|