C41H42N4OPt — CID 153417705
2-[3-[4-[(6S)-2,6-diethylcyclohex-2-en-1-yl]-3,5-diethylpyrazol-1-yl]benzene-2-id-1-yl]oxy-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153417705) has the molecular formula C41H42N4OPt and a molecular weight of 801.89 g/mol. Its IUPAC name is 2-[3-[4-[(6S)-2,6-diethylcyclohex-2-en-1-yl]-3,5-diethylpyrazol-1-yl]benzene-2-id-1-yl]oxy-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 2-[3-[4-[(6S)-2,6-diethylcyclohex-2-en-1-yl]-3,5-diethylpyrazol-1-yl]benzene-2-id-1-yl]oxy-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153417705 |
| Molecular Formula | C41H42N4OPt |
| Molecular Weight | 801.89 g/mol |
| Exact Mass | 801.30 |
| IUPAC Name | 2-[3-[4-[(6S)-2,6-diethylcyclohex-2-en-1-yl]-3,5-diethylpyrazol-1-yl]benzene-2-id-1-yl]oxy-9-(4-methyl-2-pyridinyl)-1H-carbazol-1-ide;platinum(2+) |
| SMILES | CCC1=CCC[C@H](CC)C1c1c(CC)nn(-c2[c-]c(Oc3[c-]c4c(cc3)c3ccccc3n4-c3cc(C)ccn3)ccc2)c1CC.[Pt+2] |
| InChI | InChI=1S/C41H42N4O.Pt/c1-6-28-14-12-15-29(7-2)40(28)41-35(8-3)43-45(36(41)9-4)30-16-13-17-31(25-30)46-32-20-21-34-33-18-10-11-19-37(33)44(38(34)26-32)39-24-27(5)22-23-42-39;/h10-11,13-14,16-24,29,40H,6-9,12,15H2,1-5H3;/q-2;+2/t29-,40?;/m0./s1 |
| InChIKey | HCQJDYPGVNBOJS-JMZCWHBJSA-N |
| XLogP | 10.43 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.89 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|