About 5-butan-2-yl-4-(2,6-dimethylphenyl)-1,3-di(propan-2-yl)pyrazole;platinum
5-butan-2-yl-4-(2,6-dimethylphenyl)-1,3-di(propan-2-yl)pyrazole;platinum (PubChem CID 153417775) has the molecular formula C21H32N2Pt
and a molecular weight of 507.58 g/mol. Its IUPAC name is 5-butan-2-yl-4-(2,6-dimethylphenyl)-1,3-di(propan-2-yl)pyrazole;platinum.
Molecular Properties
| Compound Name | 5-butan-2-yl-4-(2,6-dimethylphenyl)-1,3-di(propan-2-yl)pyrazole;platinum |
| PubChem CID | 153417775 |
| Molecular Formula | C21H32N2Pt |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 5-butan-2-yl-4-(2,6-dimethylphenyl)-1,3-di(propan-2-yl)pyrazole;platinum |
| SMILES | CCC(C)c1c(-c2c(C)cccc2C)c(C(C)C)nn1C(C)C.[Pt] |
| InChI | InChI=1S/C21H32N2.Pt/c1-9-15(6)21-19(18-16(7)11-10-12-17(18)8)20(13(2)3)22-23(21)14(4)5;/h10-15H,9H2,1-8H3; |
| InChIKey | UMJBXRNRYMGCJP-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-butan-2-yl-4-(2,6-dimethylphenyl)-1,3-di(propan-2-yl)pyrazole;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-4-(2,6-dimethylphenyl)-1,3-di(propan-2-yl)pyrazole;platinum?
The IUPAC name of 5-butan-2-yl-4-(2,6-dimethylphenyl)-1,3-di(propan-2-yl)pyrazole;platinum (CID 153417775) is 5-butan-2-yl-4-(2,6-dimethylphenyl)-1,3-di(propan-2-yl)pyrazole;platinum.
What is the SMILES notation for 5-butan-2-yl-4-(2,6-dimethylphenyl)-1,3-di(propan-2-yl)pyrazole;platinum?
The canonical SMILES for 5-butan-2-yl-4-(2,6-dimethylphenyl)-1,3-di(propan-2-yl)pyrazole;platinum is CCC(C)c1c(-c2c(C)cccc2C)c(C(C)C)nn1C(C)C.[Pt].
What is the InChIKey of 5-butan-2-yl-4-(2,6-dimethylphenyl)-1,3-di(propan-2-yl)pyrazole;platinum?
The InChIKey is UMJBXRNRYMGCJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32N2.Pt/c1-9-15(6)21-19(18-16(7)11-10-12-17(18)8)20(13(2)3)22-23(21)14(4)5;/h10-15H,9H2,1-8H3;.
What are the key properties of 5-butan-2-yl-4-(2,6-dimethylphenyl)-1,3-di(propan-2-yl)pyrazole;platinum?
5-butan-2-yl-4-(2,6-dimethylphenyl)-1,3-di(propan-2-yl)pyrazole;platinum has a molecular weight of 507.58 g/mol, XLogP of 6.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-4-(2,6-dimethylphenyl)-1,3-di(propan-2-yl)pyrazole;platinum is sourced from PubChem (CID 153417775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).