C29H37NO7 — CID 15341850
3-[7-[3-(4-carbamoyl-3-methoxy-2-prop-2-enylphenoxy)propoxy]-8-propyl-3,4-dihydro-2H-chromen-2-yl]propanoic acid (PubChem CID 15341850) has the molecular formula C29H37NO7 and a molecular weight of 511.62 g/mol. Its IUPAC name is 3-[7-[3-(4-carbamoyl-3-methoxy-2-prop-2-enylphenoxy)propoxy]-8-propyl-3,4-dihydro-2H-chromen-2-yl]propanoic acid.
| Compound Name | 3-[7-[3-(4-carbamoyl-3-methoxy-2-prop-2-enylphenoxy)propoxy]-8-propyl-3,4-dihydro-2H-chromen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 15341850 |
| Molecular Formula | C29H37NO7 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 3-[7-[3-(4-carbamoyl-3-methoxy-2-prop-2-enylphenoxy)propoxy]-8-propyl-3,4-dihydro-2H-chromen-2-yl]propanoic acid |
| SMILES | C=CCc1c(OCCCOc2ccc3c(c2CCC)OC(CCC(=O)O)CC3)ccc(C(N)=O)c1OC |
| InChI | InChI=1S/C29H37NO7/c1-4-7-21-24(14-10-19-9-11-20(37-27(19)21)12-16-26(31)32)35-17-6-18-36-25-15-13-23(29(30)33)28(34-3)22(25)8-5-2/h5,10,13-15,20H,2,4,6-9,11-12,16-18H2,1,3H3,(H2,30,33)(H,31,32) |
| InChIKey | GGAQPAUZTDEAEP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|