About 2-O-tert-butyl 3-O-ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate
2-O-tert-butyl 3-O-ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 153418847) has the molecular formula C30H41NO5Si
and a molecular weight of 523.75 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O-ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-tert-butyl 3-O-ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| PubChem CID | 153418847 |
| Molecular Formula | C30H41NO5Si |
| Molecular Weight | 523.75 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 2-O-tert-butyl 3-O-ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1C2CC(CC2O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H41NO5Si/c1-8-34-27(32)26-24-19-21(31(26)28(33)35-29(2,3)4)20-25(24)36-37(30(5,6)7,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h9-18,21,24-26H,8,19-20H2,1-7H3 |
| InChIKey | SDFSMIXEHHVVRV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 523.75 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-O-tert-butyl 3-O-ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-tert-butyl 3-O-ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate?
The IUPAC name of 2-O-tert-butyl 3-O-ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate (CID 153418847) is 2-O-tert-butyl 3-O-ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate.
What is the SMILES notation for 2-O-tert-butyl 3-O-ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate?
The canonical SMILES for 2-O-tert-butyl 3-O-ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate is CCOC(=O)C1C2CC(CC2O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC(C)(C)C.
What is the InChIKey of 2-O-tert-butyl 3-O-ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate?
The InChIKey is SDFSMIXEHHVVRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H41NO5Si/c1-8-34-27(32)26-24-19-21(31(26)28(33)35-29(2,3)4)20-25(24)36-37(30(5,6)7,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h9-18,21,24-26H,8,19-20H2,1-7H3.
What are the key properties of 2-O-tert-butyl 3-O-ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate?
2-O-tert-butyl 3-O-ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate has a molecular weight of 523.75 g/mol, XLogP of 4.89, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-tert-butyl 3-O-ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate is sourced from PubChem (CID 153418847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).