C31H31ClF3N3O3 — CID 153418950
(3R)-3-[[[5-chloro-2-[[(2R)-1-ethyl-2-methylpyrrolidine-2-carbonyl]amino]phenyl]-phenylmethylidene]amino]-4-(2,4,5-trifluorophenyl)butanoic acid (PubChem CID 153418950) has the molecular formula C31H31ClF3N3O3 and a molecular weight of 586.05 g/mol. Its IUPAC name is (3R)-3-[[[5-chloro-2-[[(2R)-1-ethyl-2-methylpyrrolidine-2-carbonyl]amino]phenyl]-phenylmethylidene]amino]-4-(2,4,5-trifluorophenyl)butanoic acid.
| Compound Name | (3R)-3-[[[5-chloro-2-[[(2R)-1-ethyl-2-methylpyrrolidine-2-carbonyl]amino]phenyl]-phenylmethylidene]amino]-4-(2,4,5-trifluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 153418950 |
| Molecular Formula | C31H31ClF3N3O3 |
| Molecular Weight | 586.05 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | (3R)-3-[[[5-chloro-2-[[(2R)-1-ethyl-2-methylpyrrolidine-2-carbonyl]amino]phenyl]-phenylmethylidene]amino]-4-(2,4,5-trifluorophenyl)butanoic acid |
| SMILES | CCN1CCC[C@]1(C)C(=O)Nc1ccc(Cl)cc1/C(=N/[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C31H31ClF3N3O3/c1-3-38-13-7-12-31(38,2)30(41)37-27-11-10-21(32)16-23(27)29(19-8-5-4-6-9-19)36-22(17-28(39)40)14-20-15-25(34)26(35)18-24(20)33/h4-6,8-11,15-16,18,22H,3,7,12-14,17H2,1-2H3,(H,37,41)(H,39,40)/b36-29+/t22-,31-/m1/s1 |
| InChIKey | NCKUVGCZMYSILE-FLJIPTESSA-N |
| XLogP | 6.49 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.05 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|