C32H35IrN5O3-2 — CID 153419224
(Z)-4-hydroxypent-3-en-2-one;iridium;pyridin-2-ylmethyl-[[1-(1,10,10-trimethyl-3-aza-4-azanidatricyclo[5.2.1.02,6]deca-2,5-dien-5-yl)isoquinolin-3-yl]oxymethyl]azanide (PubChem CID 153419224) has the molecular formula C32H35IrN5O3-2 and a molecular weight of 729.88 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;pyridin-2-ylmethyl-[[1-(1,10,10-trimethyl-3-aza-4-azanidatricyclo[5.2.1.02,6]deca-2,5-dien-5-yl)isoquinolin-3-yl]oxymethyl]azanide.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;pyridin-2-ylmethyl-[[1-(1,10,10-trimethyl-3-aza-4-azanidatricyclo[5.2.1.02,6]deca-2,5-dien-5-yl)isoquinolin-3-yl]oxymethyl]azanide |
|---|---|
| PubChem CID | 153419224 |
| Molecular Formula | C32H35IrN5O3-2 |
| Molecular Weight | 729.88 g/mol |
| Exact Mass | 730.24 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;pyridin-2-ylmethyl-[[1-(1,10,10-trimethyl-3-aza-4-azanidatricyclo[5.2.1.02,6]deca-2,5-dien-5-yl)isoquinolin-3-yl]oxymethyl]azanide |
| SMILES | CC(=O)/C=C(/C)O.CC12CCC(c3c1n[n-]c3-c1nc(OC[N-]Cc3ccccn3)cc3ccccc13)C2(C)C.[Ir] |
| InChI | InChI=1S/C27H27N5O.C5H8O2.Ir/c1-26(2)20-11-12-27(26,3)25-22(20)24(31-32-25)23-19-10-5-4-8-17(19)14-21(30-23)33-16-28-15-18-9-6-7-13-29-18;1-4(6)3-5(2)7;/h4-10,13-14,20H,11-12,15-16H2,1-3H3;3,6H,1-2H3;/q-2;;/b;4-3-; |
| InChIKey | MIPKUXLAVZIFBZ-LWFKIUJUSA-N |
| XLogP | 6.77 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.88 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|