About (N-[6-(phenoxy)-2-pyridinyl]anilino)methyl-(pyridin-2-ylmethyl)azanide;platinum(2+)
(N-[6-(phenoxy)-2-pyridinyl]anilino)methyl-(pyridin-2-ylmethyl)azanide;platinum(2+) (PubChem CID 153419238) has the molecular formula C24H20N4OPt
and a molecular weight of 575.53 g/mol. Its IUPAC name is (N-[6-(phenoxy)-2-pyridinyl]anilino)methyl-(pyridin-2-ylmethyl)azanide;platinum(2+).
Molecular Properties
| Compound Name | (N-[6-(phenoxy)-2-pyridinyl]anilino)methyl-(pyridin-2-ylmethyl)azanide;platinum(2+) |
| PubChem CID | 153419238 |
| Molecular Formula | C24H20N4OPt |
| Molecular Weight | 575.53 g/mol |
| Exact Mass | 575.13 |
| IUPAC Name | (N-[6-(phenoxy)-2-pyridinyl]anilino)methyl-(pyridin-2-ylmethyl)azanide;platinum(2+) |
| SMILES | [Pt+2].[c-]1ccccc1Oc1cccc(N(C[N-]Cc2ccccn2)c2ccccc2)n1 |
| InChI | InChI=1S/C24H20N4O.Pt/c1-3-11-21(12-4-1)28(19-25-18-20-10-7-8-17-26-20)23-15-9-16-24(27-23)29-22-13-5-2-6-14-22;/h1-13,15-17H,18-19H2;/q-2;+2 |
| InChIKey | DCTYZZRCFUIKRP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 52.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 575.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (N-[6-(phenoxy)-2-pyridinyl]anilino)methyl-(pyridin-2-ylmethyl)azanide;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (N-[6-(phenoxy)-2-pyridinyl]anilino)methyl-(pyridin-2-ylmethyl)azanide;platinum(2+)?
The IUPAC name of (N-[6-(phenoxy)-2-pyridinyl]anilino)methyl-(pyridin-2-ylmethyl)azanide;platinum(2+) (CID 153419238) is (N-[6-(phenoxy)-2-pyridinyl]anilino)methyl-(pyridin-2-ylmethyl)azanide;platinum(2+).
What is the SMILES notation for (N-[6-(phenoxy)-2-pyridinyl]anilino)methyl-(pyridin-2-ylmethyl)azanide;platinum(2+)?
The canonical SMILES for (N-[6-(phenoxy)-2-pyridinyl]anilino)methyl-(pyridin-2-ylmethyl)azanide;platinum(2+) is [Pt+2].[c-]1ccccc1Oc1cccc(N(C[N-]Cc2ccccn2)c2ccccc2)n1.
What is the InChIKey of (N-[6-(phenoxy)-2-pyridinyl]anilino)methyl-(pyridin-2-ylmethyl)azanide;platinum(2+)?
The InChIKey is DCTYZZRCFUIKRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N4O.Pt/c1-3-11-21(12-4-1)28(19-25-18-20-10-7-8-17-26-20)23-15-9-16-24(27-23)29-22-13-5-2-6-14-22;/h1-13,15-17H,18-19H2;/q-2;+2.
What are the key properties of (N-[6-(phenoxy)-2-pyridinyl]anilino)methyl-(pyridin-2-ylmethyl)azanide;platinum(2+)?
(N-[6-(phenoxy)-2-pyridinyl]anilino)methyl-(pyridin-2-ylmethyl)azanide;platinum(2+) has a molecular weight of 575.53 g/mol, XLogP of 5.74, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (N-[6-(phenoxy)-2-pyridinyl]anilino)methyl-(pyridin-2-ylmethyl)azanide;platinum(2+) is sourced from PubChem (CID 153419238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).