About 4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine
4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine (PubChem CID 153422495) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine.
Molecular Properties
| Compound Name | 4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine |
| PubChem CID | 153422495 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine |
| SMILES | C=C(C=CCN)NCCOC |
| InChI | InChI=1S/C8H16N2O/c1-8(4-3-5-9)10-6-7-11-2/h3-4,10H,1,5-7,9H2,2H3 |
| InChIKey | ZNZGESUBIQFPCW-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine?
The IUPAC name of 4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine (CID 153422495) is 4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine.
What is the SMILES notation for 4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine?
The canonical SMILES for 4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine is C=C(C=CCN)NCCOC.
What is the InChIKey of 4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine?
The InChIKey is ZNZGESUBIQFPCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-8(4-3-5-9)10-6-7-11-2/h3-4,10H,1,5-7,9H2,2H3.
What are the key properties of 4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine?
4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine has a molecular weight of 156.23 g/mol, XLogP of 0.25, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(2-methoxyethyl)penta-2,4-diene-1,4-diamine is sourced from PubChem (CID 153422495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).