(4E)-bicyclo[6.2.0]deca-4,9-diene-9-carboxylic acid

C11H14O2 — CID 153422541

IUPAC(4E)-bicyclo[6.2.0]deca-4,9-diene-9-carboxylic acid
SMILESO=C(O)C1=CC2CC/C=C\CCC12
InChIInChI=1S/C11H14O2/c12-11(13)10-7-8-5-3-1-2-4-6-9(8)10/h1-2,7-9H,3-6H2,(H,12,13)/b2-1-
InChIKeyNHYRHQRATMXRMJ-UPHRSURJSA-N
MW178.23 g/mol
LogP2.37
Rot. Bonds1

About (4E)-bicyclo[6.2.0]deca-4,9-diene-9-carboxylic acid

(4E)-bicyclo[6.2.0]deca-4,9-diene-9-carboxylic acid (PubChem CID 153422541) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (4E)-bicyclo[6.2.0]deca-4,9-diene-9-carboxylic acid.

Molecular Properties

Compound Name(4E)-bicyclo[6.2.0]deca-4,9-diene-9-carboxylic acid
PubChem CID153422541
Molecular FormulaC11H14O2
Molecular Weight178.23 g/mol
Exact Mass178.10
IUPAC Name(4E)-bicyclo[6.2.0]deca-4,9-diene-9-carboxylic acid
SMILESO=C(O)C1=CC2CC/C=C\CCC12
InChIInChI=1S/C11H14O2/c12-11(13)10-7-8-5-3-1-2-4-6-9(8)10/h1-2,7-9H,3-6H2,(H,12,13)/b2-1-
InChIKeyNHYRHQRATMXRMJ-UPHRSURJSA-N
XLogP2.37
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.23
LogP ≤ 52.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (4E)-bicyclo[6.2.0]deca-4,9-diene-9-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4E)-bicyclo[6.2.0]deca-4,9-diene-9-carboxylic acid?
The IUPAC name of (4E)-bicyclo[6.2.0]deca-4,9-diene-9-carboxylic acid (CID 153422541) is (4E)-bicyclo[6.2.0]deca-4,9-diene-9-carboxylic acid.
What is the SMILES notation for (4E)-bicyclo[6.2.0]deca-4,9-diene-9-carboxylic acid?
The canonical SMILES for (4E)-bicyclo[6.2.0]deca-4,9-diene-9-carboxylic acid is O=C(O)C1=CC2CC/C=C\CCC12.
What is the InChIKey of (4E)-bicyclo[6.2.0]deca-4,9-diene-9-carboxylic acid?
The InChIKey is NHYRHQRATMXRMJ-UPHRSURJSA-N. The full InChI is InChI=1S/C11H14O2/c12-11(13)10-7-8-5-3-1-2-4-6-9(8)10/h1-2,7-9H,3-6H2,(H,12,13)/b2-1-.
What are the key properties of (4E)-bicyclo[6.2.0]deca-4,9-diene-9-carboxylic acid?
(4E)-bicyclo[6.2.0]deca-4,9-diene-9-carboxylic acid has a molecular weight of 178.23 g/mol, XLogP of 2.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-bicyclo[6.2.0]deca-4,9-diene-9-carboxylic acid is sourced from PubChem (CID 153422541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).