C48H38N4 — CID 153422736
10-[3-(2,3-dimethylimidazo[1,2-f]phenanthridin-10-yl)-2-(3,5-dimethylphenyl)phenyl]-2,3-dimethylimidazo[1,2-f]phenanthridine (PubChem CID 153422736) has the molecular formula C48H38N4 and a molecular weight of 670.86 g/mol. Its IUPAC name is 10-[3-(2,3-dimethylimidazo[1,2-f]phenanthridin-10-yl)-2-(3,5-dimethylphenyl)phenyl]-2,3-dimethylimidazo[1,2-f]phenanthridine.
| Compound Name | 10-[3-(2,3-dimethylimidazo[1,2-f]phenanthridin-10-yl)-2-(3,5-dimethylphenyl)phenyl]-2,3-dimethylimidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 153422736 |
| Molecular Formula | C48H38N4 |
| Molecular Weight | 670.86 g/mol |
| Exact Mass | 670.31 |
| IUPAC Name | 10-[3-(2,3-dimethylimidazo[1,2-f]phenanthridin-10-yl)-2-(3,5-dimethylphenyl)phenyl]-2,3-dimethylimidazo[1,2-f]phenanthridine |
| SMILES | Cc1cc(C)cc(-c2c(-c3ccc4c(c3)c3ccccc3n3c(C)c(C)nc43)cccc2-c2ccc3c(c2)c2ccccc2n2c(C)c(C)nc32)c1 |
| InChI | InChI=1S/C48H38N4/c1-27-22-28(2)24-35(23-27)46-36(33-18-20-40-42(25-33)38-12-7-9-16-44(38)51-31(5)29(3)49-47(40)51)14-11-15-37(46)34-19-21-41-43(26-34)39-13-8-10-17-45(39)52-32(6)30(4)50-48(41)52/h7-26H,1-6H3 |
| InChIKey | VOCXYNSDZHSGLD-UHFFFAOYSA-N |
| XLogP | 12.45 |
| TPSA | 34.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.86 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|