About propyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]-6-propylcarbazole-3-carboxylate
propyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]-6-propylcarbazole-3-carboxylate (PubChem CID 153423231) has the molecular formula C33H27Br2NO2
and a molecular weight of 629.39 g/mol. Its IUPAC name is propyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]-6-propylcarbazole-3-carboxylate.
Molecular Properties
| Compound Name | propyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]-6-propylcarbazole-3-carboxylate |
| PubChem CID | 153423231 |
| Molecular Formula | C33H27Br2NO2 |
| Molecular Weight | 629.39 g/mol |
| Exact Mass | 627.04 |
| IUPAC Name | propyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]-6-propylcarbazole-3-carboxylate |
| SMILES | CCCOC(=O)c1ccc2c(c1)c1cc(CCC)ccc1n2-c1ccc(C#Cc2cc(Br)cc(Br)c2)cc1 |
| InChI | InChI=1S/C33H27Br2NO2/c1-3-5-23-10-14-31-29(19-23)30-20-25(33(37)38-16-4-2)11-15-32(30)36(31)28-12-8-22(9-13-28)6-7-24-17-26(34)21-27(35)18-24/h8-15,17-21H,3-5,16H2,1-2H3 |
| InChIKey | OJLPCCQANZKMKO-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 629.39 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze propyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]-6-propylcarbazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]-6-propylcarbazole-3-carboxylate?
The IUPAC name of propyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]-6-propylcarbazole-3-carboxylate (CID 153423231) is propyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]-6-propylcarbazole-3-carboxylate.
What is the SMILES notation for propyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]-6-propylcarbazole-3-carboxylate?
The canonical SMILES for propyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]-6-propylcarbazole-3-carboxylate is CCCOC(=O)c1ccc2c(c1)c1cc(CCC)ccc1n2-c1ccc(C#Cc2cc(Br)cc(Br)c2)cc1.
What is the InChIKey of propyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]-6-propylcarbazole-3-carboxylate?
The InChIKey is OJLPCCQANZKMKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H27Br2NO2/c1-3-5-23-10-14-31-29(19-23)30-20-25(33(37)38-16-4-2)11-15-32(30)36(31)28-12-8-22(9-13-28)6-7-24-17-26(34)21-27(35)18-24/h8-15,17-21H,3-5,16H2,1-2H3.
What are the key properties of propyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]-6-propylcarbazole-3-carboxylate?
propyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]-6-propylcarbazole-3-carboxylate has a molecular weight of 629.39 g/mol, XLogP of 9.23, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 9-[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]-6-propylcarbazole-3-carboxylate is sourced from PubChem (CID 153423231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).