C37H30N4OPt — CID 153423548
3-[1-(2,6-dimethylphenyl)-2-pyridin-2-yloxyimidazol-4-yl]-9,9-dimethyl-10-phenyl-4H-acridin-4-ide;platinum(2+) (PubChem CID 153423548) has the molecular formula C37H30N4OPt and a molecular weight of 741.75 g/mol. Its IUPAC name is 3-[1-(2,6-dimethylphenyl)-2-pyridin-2-yloxyimidazol-4-yl]-9,9-dimethyl-10-phenyl-4H-acridin-4-ide;platinum(2+).
| Compound Name | 3-[1-(2,6-dimethylphenyl)-2-pyridin-2-yloxyimidazol-4-yl]-9,9-dimethyl-10-phenyl-4H-acridin-4-ide;platinum(2+) |
|---|---|
| PubChem CID | 153423548 |
| Molecular Formula | C37H30N4OPt |
| Molecular Weight | 741.75 g/mol |
| Exact Mass | 741.21 |
| IUPAC Name | 3-[1-(2,6-dimethylphenyl)-2-pyridin-2-yloxyimidazol-4-yl]-9,9-dimethyl-10-phenyl-4H-acridin-4-ide;platinum(2+) |
| SMILES | Cc1cccc(C)c1-n1cc(-c2[c-]c3c(cc2)C(C)(C)c2ccccc2N3c2[c-]cccc2)nc1Oc1ccccn1.[Pt+2] |
| InChI | InChI=1S/C37H30N4O.Pt/c1-25-13-12-14-26(2)35(25)40-24-31(39-36(40)42-34-19-10-11-22-38-34)27-20-21-30-33(23-27)41(28-15-6-5-7-16-28)32-18-9-8-17-29(32)37(30,3)4;/h5-15,17-22,24H,1-4H3;/q-2;+2 |
| InChIKey | PMMRTAZGYIJXTL-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.75 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|