About 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]furo[2,3-b]pyridine
3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]furo[2,3-b]pyridine (PubChem CID 15342355) has the molecular formula C19H17ClN2O
and a molecular weight of 324.81 g/mol. Its IUPAC name is 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]furo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]furo[2,3-b]pyridine |
| PubChem CID | 15342355 |
| Molecular Formula | C19H17ClN2O |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]furo[2,3-b]pyridine |
| SMILES | Clc1ccc(C2=CCN(Cc3coc4ncccc34)CC2)cc1 |
| InChI | InChI=1S/C19H17ClN2O/c20-17-5-3-14(4-6-17)15-7-10-22(11-8-15)12-16-13-23-19-18(16)2-1-9-21-19/h1-7,9,13H,8,10-12H2 |
| InChIKey | IDKSLRVELCRXAH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]furo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]furo[2,3-b]pyridine?
The IUPAC name of 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]furo[2,3-b]pyridine (CID 15342355) is 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]furo[2,3-b]pyridine.
What is the SMILES notation for 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]furo[2,3-b]pyridine?
The canonical SMILES for 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]furo[2,3-b]pyridine is Clc1ccc(C2=CCN(Cc3coc4ncccc34)CC2)cc1.
What is the InChIKey of 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]furo[2,3-b]pyridine?
The InChIKey is IDKSLRVELCRXAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClN2O/c20-17-5-3-14(4-6-17)15-7-10-22(11-8-15)12-16-13-23-19-18(16)2-1-9-21-19/h1-7,9,13H,8,10-12H2.
What are the key properties of 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]furo[2,3-b]pyridine?
3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]furo[2,3-b]pyridine has a molecular weight of 324.81 g/mol, XLogP of 4.77, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]furo[2,3-b]pyridine is sourced from PubChem (CID 15342355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).