C18H32N4O5 — CID 153424059
3-methoxy-N-[(1R)-5-[5-(methoxymethyl)-1,2,4-oxadiazolidin-3-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-1,2-oxazolidine-5-carboxamide (PubChem CID 153424059) has the molecular formula C18H32N4O5 and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-methoxy-N-[(1R)-5-[5-(methoxymethyl)-1,2,4-oxadiazolidin-3-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-1,2-oxazolidine-5-carboxamide.
| Compound Name | 3-methoxy-N-[(1R)-5-[5-(methoxymethyl)-1,2,4-oxadiazolidin-3-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-1,2-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 153424059 |
| Molecular Formula | C18H32N4O5 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 3-methoxy-N-[(1R)-5-[5-(methoxymethyl)-1,2,4-oxadiazolidin-3-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-1,2-oxazolidine-5-carboxamide |
| SMILES | COCC1NC(C2CCC3C(CC[C@H]3NC(=O)C3CC(OC)NO3)C2)NO1 |
| InChI | InChI=1S/C18H32N4O5/c1-24-9-16-20-17(22-27-16)11-3-5-12-10(7-11)4-6-13(12)19-18(23)14-8-15(25-2)21-26-14/h10-17,20-22H,3-9H2,1-2H3,(H,19,23)/t10?,11?,12?,13-,14?,15?,16?,17?/m1/s1 |
| InChIKey | DYNRGGVNKRNUGK-LFWZRRHXSA-N |
| XLogP | -0.01 |
| TPSA | 102.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |