C19H35N5O2 — CID 153424105
N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-5-methyl-1,3-diazinane-4-carboxamide (PubChem CID 153424105) has the molecular formula C19H35N5O2 and a molecular weight of 365.52 g/mol. Its IUPAC name is N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-5-methyl-1,3-diazinane-4-carboxamide.
| Compound Name | N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-5-methyl-1,3-diazinane-4-carboxamide |
|---|---|
| PubChem CID | 153424105 |
| Molecular Formula | C19H35N5O2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | N-[(1R)-5-(5-ethyl-1,2,4-oxadiazolidin-3-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-5-methyl-1,3-diazinane-4-carboxamide |
| SMILES | CCC1NC(C2CCC3C(CC[C@H]3NC(=O)C3NCNCC3C)C2)NO1 |
| InChI | InChI=1S/C19H35N5O2/c1-3-16-23-18(24-26-16)13-4-6-14-12(8-13)5-7-15(14)22-19(25)17-11(2)9-20-10-21-17/h11-18,20-21,23-24H,3-10H2,1-2H3,(H,22,25)/t11?,12?,13?,14?,15-,16?,17?,18?/m1/s1 |
| InChIKey | LOKMILRCMUUALD-YFMWHPRPSA-N |
| XLogP | 0.64 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |