C27H38FN5O3Si — CID 153424229
benzyl N-[[(2S,4S)-1-(5-amino-7-fluoro-1-methylindazol-4-yl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]methyl]carbamate (PubChem CID 153424229) has the molecular formula C27H38FN5O3Si and a molecular weight of 527.72 g/mol. Its IUPAC name is benzyl N-[[(2S,4S)-1-(5-amino-7-fluoro-1-methylindazol-4-yl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(2S,4S)-1-(5-amino-7-fluoro-1-methylindazol-4-yl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 153424229 |
| Molecular Formula | C27H38FN5O3Si |
| Molecular Weight | 527.72 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | benzyl N-[[(2S,4S)-1-(5-amino-7-fluoro-1-methylindazol-4-yl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]methyl]carbamate |
| SMILES | Cn1ncc2c(N3C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]3CNC(=O)OCc3ccccc3)c(N)cc(F)c21 |
| InChI | InChI=1S/C27H38FN5O3Si/c1-27(2,3)37(5,6)36-20-12-19(14-30-26(34)35-17-18-10-8-7-9-11-18)33(16-20)25-21-15-31-32(4)24(21)22(28)13-23(25)29/h7-11,13,15,19-20H,12,14,16-17,29H2,1-6H3,(H,30,34)/t19-,20-/m0/s1 |
| InChIKey | HOQDHARQYUYMET-PMACEKPBSA-N |
| XLogP | 5.19 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.72 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|