C23H36FN5O5Si — CID 153424231
tert-butyl N-[(3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(7-fluoro-5-nitro-1H-indazol-4-yl)pyrrolidin-3-yl]carbamate (PubChem CID 153424231) has the molecular formula C23H36FN5O5Si and a molecular weight of 509.66 g/mol. Its IUPAC name is tert-butyl N-[(3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(7-fluoro-5-nitro-1H-indazol-4-yl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(7-fluoro-5-nitro-1H-indazol-4-yl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 153424231 |
| Molecular Formula | C23H36FN5O5Si |
| Molecular Weight | 509.66 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | tert-butyl N-[(3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(7-fluoro-5-nitro-1H-indazol-4-yl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H](CO[Si](C)(C)C(C)(C)C)N(c2c([N+](=O)[O-])cc(F)c3[nH]ncc23)C1 |
| InChI | InChI=1S/C23H36FN5O5Si/c1-22(2,3)34-21(30)26-14-9-15(13-33-35(7,8)23(4,5)6)28(12-14)20-16-11-25-27-19(16)17(24)10-18(20)29(31)32/h10-11,14-15H,9,12-13H2,1-8H3,(H,25,27)(H,26,30)/t14-,15-/m0/s1 |
| InChIKey | LPEYLZNDCYHOOW-GJZGRUSLSA-N |
| XLogP | 5.10 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.66 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|