C7H14Br3N — CID 153424545
1,3-dibromo-N-(2-bromoethyl)-N-ethylpropan-2-amine (PubChem CID 153424545) has the molecular formula C7H14Br3N and a molecular weight of 351.91 g/mol. Its IUPAC name is 1,3-dibromo-N-(2-bromoethyl)-N-ethylpropan-2-amine.
| Compound Name | 1,3-dibromo-N-(2-bromoethyl)-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 153424545 |
| Molecular Formula | C7H14Br3N |
| Molecular Weight | 351.91 g/mol |
| Exact Mass | 348.87 |
| IUPAC Name | 1,3-dibromo-N-(2-bromoethyl)-N-ethylpropan-2-amine |
| SMILES | CCN(CCBr)C(CBr)CBr |
| InChI | InChI=1S/C7H14Br3N/c1-2-11(4-3-8)7(5-9)6-10/h7H,2-6H2,1H3 |
| InChIKey | LPPUYNKZRWOMEZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.91 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|