C12H20N3O2P — CID 153425572
2-[(E)-1-[(6S)-9-azabicyclo[4.2.1]non-2-en-2-yl]ethylideneamino]oxy-N-phosphanylacetamide (PubChem CID 153425572) has the molecular formula C12H20N3O2P and a molecular weight of 269.28 g/mol. Its IUPAC name is 2-[(E)-1-[(6S)-9-azabicyclo[4.2.1]non-2-en-2-yl]ethylideneamino]oxy-N-phosphanylacetamide.
| Compound Name | 2-[(E)-1-[(6S)-9-azabicyclo[4.2.1]non-2-en-2-yl]ethylideneamino]oxy-N-phosphanylacetamide |
|---|---|
| PubChem CID | 153425572 |
| Molecular Formula | C12H20N3O2P |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-[(E)-1-[(6S)-9-azabicyclo[4.2.1]non-2-en-2-yl]ethylideneamino]oxy-N-phosphanylacetamide |
| SMILES | C/C(=N\OCC(=O)NP)C1=CCC[C@H]2CCC1N2 |
| InChI | InChI=1S/C12H20N3O2P/c1-8(14-17-7-12(16)15-18)10-4-2-3-9-5-6-11(10)13-9/h4,9,11,13H,2-3,5-7,18H2,1H3,(H,15,16)/b14-8+/t9-,11?/m0/s1 |
| InChIKey | BVCKJSMXXZPESK-AMKMDCMZSA-N |
| XLogP | 1.13 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|