C23H29N3OSi — CID 153426011
(1S,3R)-N,N-dimethyl-1-(4-trimethylsilylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 153426011) has the molecular formula C23H29N3OSi and a molecular weight of 391.59 g/mol. Its IUPAC name is (1S,3R)-N,N-dimethyl-1-(4-trimethylsilylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | (1S,3R)-N,N-dimethyl-1-(4-trimethylsilylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 153426011 |
| Molecular Formula | C23H29N3OSi |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (1S,3R)-N,N-dimethyl-1-(4-trimethylsilylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1Cc2c([nH]c3ccccc23)[C@H](c2ccc([Si](C)(C)C)cc2)N1 |
| InChI | InChI=1S/C23H29N3OSi/c1-26(2)23(27)20-14-18-17-8-6-7-9-19(17)24-22(18)21(25-20)15-10-12-16(13-11-15)28(3,4)5/h6-13,20-21,24-25H,14H2,1-5H3/t20-,21+/m1/s1 |
| InChIKey | XUKXUIPDTPTIJF-RTWAWAEBSA-N |
| XLogP | 3.40 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|