About N-ethyl-N-methylethanamine;tetrakis(yttrium)
N-ethyl-N-methylethanamine;tetrakis(yttrium) (PubChem CID 153426432) has the molecular formula C5H11NY4-2
and a molecular weight of 440.77 g/mol. Its IUPAC name is N-ethyl-N-methylethanamine;tetrakis(yttrium).
Molecular Properties
| Compound Name | N-ethyl-N-methylethanamine;tetrakis(yttrium) |
| PubChem CID | 153426432 |
| Molecular Formula | C5H11NY4-2 |
| Molecular Weight | 440.77 g/mol |
| Exact Mass | 440.71 |
| IUPAC Name | N-ethyl-N-methylethanamine;tetrakis(yttrium) |
| SMILES | [CH2-]CN(C)C[CH2-].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C5H11N.4Y/c1-4-6(3)5-2;;;;/h1-2,4-5H2,3H3;;;;/q-2;;;; |
| InChIKey | PMXOVZUVECQSEZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.77 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-methylethanamine;tetrakis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methylethanamine;tetrakis(yttrium)?
The IUPAC name of N-ethyl-N-methylethanamine;tetrakis(yttrium) (CID 153426432) is N-ethyl-N-methylethanamine;tetrakis(yttrium).
What is the SMILES notation for N-ethyl-N-methylethanamine;tetrakis(yttrium)?
The canonical SMILES for N-ethyl-N-methylethanamine;tetrakis(yttrium) is [CH2-]CN(C)C[CH2-].[Y].[Y].[Y].[Y].
What is the InChIKey of N-ethyl-N-methylethanamine;tetrakis(yttrium)?
The InChIKey is PMXOVZUVECQSEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.4Y/c1-4-6(3)5-2;;;;/h1-2,4-5H2,3H3;;;;/q-2;;;;.
What are the key properties of N-ethyl-N-methylethanamine;tetrakis(yttrium)?
N-ethyl-N-methylethanamine;tetrakis(yttrium) has a molecular weight of 440.77 g/mol, XLogP of 0.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methylethanamine;tetrakis(yttrium) is sourced from PubChem (CID 153426432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).