About 3aH-pyrazolo[1,5-b]pyridazin-8-ium
3aH-pyrazolo[1,5-b]pyridazin-8-ium (PubChem CID 153427122) has the molecular formula C6H6N3+
and a molecular weight of 120.13 g/mol. Its IUPAC name is 3aH-pyrazolo[1,5-b]pyridazin-8-ium.
Molecular Properties
| Compound Name | 3aH-pyrazolo[1,5-b]pyridazin-8-ium |
| PubChem CID | 153427122 |
| Molecular Formula | C6H6N3+ |
| Molecular Weight | 120.13 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | 3aH-pyrazolo[1,5-b]pyridazin-8-ium |
| SMILES | C1=CC2C=CN=[N+]2N=C1 |
| InChI | InChI=1S/C6H6N3/c1-2-6-3-5-8-9(6)7-4-1/h1-6H/q+1 |
| InChIKey | BJEIWZQRUJKXCQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 27.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.13 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3aH-pyrazolo[1,5-b]pyridazin-8-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3aH-pyrazolo[1,5-b]pyridazin-8-ium?
The IUPAC name of 3aH-pyrazolo[1,5-b]pyridazin-8-ium (CID 153427122) is 3aH-pyrazolo[1,5-b]pyridazin-8-ium.
What is the SMILES notation for 3aH-pyrazolo[1,5-b]pyridazin-8-ium?
The canonical SMILES for 3aH-pyrazolo[1,5-b]pyridazin-8-ium is C1=CC2C=CN=[N+]2N=C1.
What is the InChIKey of 3aH-pyrazolo[1,5-b]pyridazin-8-ium?
The InChIKey is BJEIWZQRUJKXCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N3/c1-2-6-3-5-8-9(6)7-4-1/h1-6H/q+1.
What are the key properties of 3aH-pyrazolo[1,5-b]pyridazin-8-ium?
3aH-pyrazolo[1,5-b]pyridazin-8-ium has a molecular weight of 120.13 g/mol, XLogP of 0.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3aH-pyrazolo[1,5-b]pyridazin-8-ium is sourced from PubChem (CID 153427122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).