C19H32O6 — CID 15342727
tert-butyl (1R,2S,3S,4S,5S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-ethyl-1-hydroxy-8-oxabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 15342727) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is tert-butyl (1R,2S,3S,4S,5S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-ethyl-1-hydroxy-8-oxabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | tert-butyl (1R,2S,3S,4S,5S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-ethyl-1-hydroxy-8-oxabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 15342727 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | tert-butyl (1R,2S,3S,4S,5S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-ethyl-1-hydroxy-8-oxabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | CC[C@H]1[C@@H](C(=O)OC(C)(C)C)[C@H]([C@H]2COC(C)(C)O2)[C@@H]2CC[C@@]1(O)O2 |
| InChI | InChI=1S/C19H32O6/c1-7-11-14(16(20)25-17(2,3)4)15(12-8-9-19(11,21)24-12)13-10-22-18(5,6)23-13/h11-15,21H,7-10H2,1-6H3/t11-,12-,13+,14+,15-,19+/m0/s1 |
| InChIKey | JNMODLBBQWYZSH-QUYUGOAUSA-N |
| XLogP | 2.62 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |