C13H15NO2 — CID 153428064
[(1E,3Z)-5-methylhexa-1,3,5-trienyl] (E)-4-ethenyliminobut-2-enoate (PubChem CID 153428064) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is [(1E,3Z)-5-methylhexa-1,3,5-trienyl] (E)-4-ethenyliminobut-2-enoate.
| Compound Name | [(1E,3Z)-5-methylhexa-1,3,5-trienyl] (E)-4-ethenyliminobut-2-enoate |
|---|---|
| PubChem CID | 153428064 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | [(1E,3Z)-5-methylhexa-1,3,5-trienyl] (E)-4-ethenyliminobut-2-enoate |
| SMILES | C=C/N=C/C=C/C(=O)O/C=C/C=C\C(=C)C |
| InChI | InChI=1S/C13H15NO2/c1-4-14-10-7-9-13(15)16-11-6-5-8-12(2)3/h4-11H,1-2H2,3H3/b8-5-,9-7+,11-6+,14-10+ |
| InChIKey | QFWWEOBFFINGHN-NTVKBGGTSA-N |
| XLogP | 2.95 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|