About 5-[5-[3-(1,3-benzothiazol-2-yl)-3-fluorocyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-olate
5-[5-[3-(1,3-benzothiazol-2-yl)-3-fluorocyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-olate (PubChem CID 153428147) has the molecular formula C18H12FN4O3S-
and a molecular weight of 383.38 g/mol. Its IUPAC name is 5-[5-[3-(1,3-benzothiazol-2-yl)-3-fluorocyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-olate.
Molecular Properties
| Compound Name | 5-[5-[3-(1,3-benzothiazol-2-yl)-3-fluorocyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-olate |
| PubChem CID | 153428147 |
| Molecular Formula | C18H12FN4O3S- |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 5-[5-[3-(1,3-benzothiazol-2-yl)-3-fluorocyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-olate |
| SMILES | [O-]c1cc(-c2cnc(OC3CC(F)(c4nc5ccccc5s4)C3)cn2)on1 |
| InChI | InChI=1S/C18H13FN4O3S/c19-18(17-22-11-3-1-2-4-14(11)27-17)6-10(7-18)25-16-9-20-12(8-21-16)13-5-15(24)23-26-13/h1-5,8-10H,6-7H2,(H,23,24)/p-1 |
| InChIKey | KMXCPKWQBFQNKT-UHFFFAOYSA-M |
| XLogP | 3.22 |
| TPSA | 96.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-[5-[3-(1,3-benzothiazol-2-yl)-3-fluorocyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[3-(1,3-benzothiazol-2-yl)-3-fluorocyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-olate?
The IUPAC name of 5-[5-[3-(1,3-benzothiazol-2-yl)-3-fluorocyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-olate (CID 153428147) is 5-[5-[3-(1,3-benzothiazol-2-yl)-3-fluorocyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-olate.
What is the SMILES notation for 5-[5-[3-(1,3-benzothiazol-2-yl)-3-fluorocyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-olate?
The canonical SMILES for 5-[5-[3-(1,3-benzothiazol-2-yl)-3-fluorocyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-olate is [O-]c1cc(-c2cnc(OC3CC(F)(c4nc5ccccc5s4)C3)cn2)on1.
What is the InChIKey of 5-[5-[3-(1,3-benzothiazol-2-yl)-3-fluorocyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-olate?
The InChIKey is KMXCPKWQBFQNKT-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H13FN4O3S/c19-18(17-22-11-3-1-2-4-14(11)27-17)6-10(7-18)25-16-9-20-12(8-21-16)13-5-15(24)23-26-13/h1-5,8-10H,6-7H2,(H,23,24)/p-1.
What are the key properties of 5-[5-[3-(1,3-benzothiazol-2-yl)-3-fluorocyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-olate?
5-[5-[3-(1,3-benzothiazol-2-yl)-3-fluorocyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-olate has a molecular weight of 383.38 g/mol, XLogP of 3.22, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[3-(1,3-benzothiazol-2-yl)-3-fluorocyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-olate is sourced from PubChem (CID 153428147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).