About CID 153428165
CID 153428165 (PubChem CID 153428165) has the molecular formula C25H14F3IrN7-2
and a molecular weight of 661.65 g/mol.
Molecular Properties
| Compound Name | CID 153428165 |
| PubChem CID | 153428165 |
| Molecular Formula | C25H14F3IrN7-2 |
| Molecular Weight | 661.65 g/mol |
| Exact Mass | 662.09 |
| IUPAC Name | — |
| SMILES | Cc1cn2c3ccccc3c3nc(C#N)c[c-]c3c2n1.FC(F)(F)c1cc(-c2ccccn2)[n-]n1.[Ir] |
| InChI | InChI=1S/C16H9N4.C9H5F3N3.Ir/c1-10-9-20-14-5-3-2-4-12(14)15-13(16(20)18-10)7-6-11(8-17)19-15;10-9(11,12)8-5-7(14-15-8)6-3-1-2-4-13-6;/h2-6,9H,1H3;1-5H;/q2*-1; |
| InChIKey | WTGBATFGLINDRT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 93.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 661.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 153428165 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153428165?
The IUPAC name of CID 153428165 (CID 153428165) is not available.
What is the SMILES notation for CID 153428165?
The canonical SMILES for CID 153428165 is Cc1cn2c3ccccc3c3nc(C#N)c[c-]c3c2n1.FC(F)(F)c1cc(-c2ccccn2)[n-]n1.[Ir].
What is the InChIKey of CID 153428165?
The InChIKey is WTGBATFGLINDRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9N4.C9H5F3N3.Ir/c1-10-9-20-14-5-3-2-4-12(14)15-13(16(20)18-10)7-6-11(8-17)19-15;10-9(11,12)8-5-7(14-15-8)6-3-1-2-4-13-6;/h2-6,9H,1H3;1-5H;/q2*-1;.
What are the key properties of CID 153428165?
CID 153428165 has a molecular weight of 661.65 g/mol, XLogP of 5.13, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153428165 is sourced from PubChem (CID 153428165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).