C28H18F6IrN8-2 — CID 153428170
CID 153428170 (PubChem CID 153428170) has the molecular formula C28H18F6IrN8-2 and a molecular weight of 772.71 g/mol.
| Compound Name | CID 153428170 |
|---|---|
| PubChem CID | 153428170 |
| Molecular Formula | C28H18F6IrN8-2 |
| Molecular Weight | 772.71 g/mol |
| Exact Mass | 773.12 |
| IUPAC Name | — |
| SMILES | Cc1c(C)n(C)c2cc(-c3nc(C(F)(F)F)n[n-]3)ncc12.FC(F)(F)c1c[c-]c2c(n1)c1ccccc1n1ccnc21.[Ir] |
| InChI | InChI=1S/C15H7F3N3.C13H11F3N5.Ir/c16-15(17,18)12-6-5-10-13(20-12)9-3-1-2-4-11(9)21-8-7-19-14(10)21;1-6-7(2)21(3)10-4-9(17-5-8(6)10)11-18-12(20-19-11)13(14,15)16;/h1-4,6-8H;4-5H,1-3H3;/q2*-1; |
| InChIKey | OCTHCKSWPGFDIK-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 87.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.71 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|