C18H27NO11 — CID 153429793
ethyl 2-[[2-acetyloxy-2-[(3S,4R,5R)-4,5-diacetyloxy-3-hydroxyoxan-2-yl]acetyl]-methylamino]acetate (PubChem CID 153429793) has the molecular formula C18H27NO11 and a molecular weight of 433.41 g/mol. Its IUPAC name is ethyl 2-[[2-acetyloxy-2-[(3S,4R,5R)-4,5-diacetyloxy-3-hydroxyoxan-2-yl]acetyl]-methylamino]acetate.
| Compound Name | ethyl 2-[[2-acetyloxy-2-[(3S,4R,5R)-4,5-diacetyloxy-3-hydroxyoxan-2-yl]acetyl]-methylamino]acetate |
|---|---|
| PubChem CID | 153429793 |
| Molecular Formula | C18H27NO11 |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | ethyl 2-[[2-acetyloxy-2-[(3S,4R,5R)-4,5-diacetyloxy-3-hydroxyoxan-2-yl]acetyl]-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)C(=O)C(OC(C)=O)C1OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1O |
| InChI | InChI=1S/C18H27NO11/c1-6-26-13(23)7-19(5)18(25)17(30-11(4)22)16-14(24)15(29-10(3)21)12(8-27-16)28-9(2)20/h12,14-17,24H,6-8H2,1-5H3/t12-,14-,15+,16?,17?/m1/s1 |
| InChIKey | SPFOYDFZZZTXGS-QZFZYLJTSA-N |
| XLogP | -1.44 |
| TPSA | 154.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|