About (2S)-3-(2,4-dimethylphenyl)-4-isocyano-1,2-dimethyl-2H-imidazole
(2S)-3-(2,4-dimethylphenyl)-4-isocyano-1,2-dimethyl-2H-imidazole (PubChem CID 153430387) has the molecular formula C14H17N3
and a molecular weight of 227.31 g/mol. Its IUPAC name is (2S)-3-(2,4-dimethylphenyl)-4-isocyano-1,2-dimethyl-2H-imidazole.
Molecular Properties
| Compound Name | (2S)-3-(2,4-dimethylphenyl)-4-isocyano-1,2-dimethyl-2H-imidazole |
| PubChem CID | 153430387 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | (2S)-3-(2,4-dimethylphenyl)-4-isocyano-1,2-dimethyl-2H-imidazole |
| SMILES | [C-]#[N+]C1=CN(C)[C@H](C)N1c1ccc(C)cc1C |
| InChI | InChI=1S/C14H17N3/c1-10-6-7-13(11(2)8-10)17-12(3)16(5)9-14(17)15-4/h6-9,12H,1-3,5H3/t12-/m0/s1 |
| InChIKey | HHLQRQGBXDBTLN-LBPRGKRZSA-N |
| XLogP | 3.12 |
| TPSA | 10.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3-(2,4-dimethylphenyl)-4-isocyano-1,2-dimethyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-(2,4-dimethylphenyl)-4-isocyano-1,2-dimethyl-2H-imidazole?
The IUPAC name of (2S)-3-(2,4-dimethylphenyl)-4-isocyano-1,2-dimethyl-2H-imidazole (CID 153430387) is (2S)-3-(2,4-dimethylphenyl)-4-isocyano-1,2-dimethyl-2H-imidazole.
What is the SMILES notation for (2S)-3-(2,4-dimethylphenyl)-4-isocyano-1,2-dimethyl-2H-imidazole?
The canonical SMILES for (2S)-3-(2,4-dimethylphenyl)-4-isocyano-1,2-dimethyl-2H-imidazole is [C-]#[N+]C1=CN(C)[C@H](C)N1c1ccc(C)cc1C.
What is the InChIKey of (2S)-3-(2,4-dimethylphenyl)-4-isocyano-1,2-dimethyl-2H-imidazole?
The InChIKey is HHLQRQGBXDBTLN-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H17N3/c1-10-6-7-13(11(2)8-10)17-12(3)16(5)9-14(17)15-4/h6-9,12H,1-3,5H3/t12-/m0/s1.
What are the key properties of (2S)-3-(2,4-dimethylphenyl)-4-isocyano-1,2-dimethyl-2H-imidazole?
(2S)-3-(2,4-dimethylphenyl)-4-isocyano-1,2-dimethyl-2H-imidazole has a molecular weight of 227.31 g/mol, XLogP of 3.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-(2,4-dimethylphenyl)-4-isocyano-1,2-dimethyl-2H-imidazole is sourced from PubChem (CID 153430387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).