C22H16F2N4O — CID 153430413
8-[(2S)-4,6-difluoro-5-isocyano-2,3-dimethyl-2H-benzimidazol-1-yl]-7-methyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 153430413) has the molecular formula C22H16F2N4O and a molecular weight of 390.39 g/mol. Its IUPAC name is 8-[(2S)-4,6-difluoro-5-isocyano-2,3-dimethyl-2H-benzimidazol-1-yl]-7-methyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 8-[(2S)-4,6-difluoro-5-isocyano-2,3-dimethyl-2H-benzimidazol-1-yl]-7-methyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 153430413 |
| Molecular Formula | C22H16F2N4O |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 8-[(2S)-4,6-difluoro-5-isocyano-2,3-dimethyl-2H-benzimidazol-1-yl]-7-methyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | [C-]#[N+]c1c(F)cc2c(c1F)N(C)[C@H](C)N2c1c(C)ccc2c1oc1ncccc12 |
| InChI | InChI=1S/C22H16F2N4O/c1-11-7-8-13-14-6-5-9-26-22(14)29-21(13)19(11)28-12(2)27(4)20-16(28)10-15(23)18(25-3)17(20)24/h5-10,12H,1-2,4H3/t12-/m0/s1 |
| InChIKey | IADIFXXHVXKATE-LBPRGKRZSA-N |
| XLogP | 6.05 |
| TPSA | 36.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|