C18H17F2N3 — CID 153430443
(2S)-1-(2,5-dimethylphenyl)-4,6-difluoro-5-isocyano-2,3-dimethyl-2H-benzimidazole (PubChem CID 153430443) has the molecular formula C18H17F2N3 and a molecular weight of 313.35 g/mol. Its IUPAC name is (2S)-1-(2,5-dimethylphenyl)-4,6-difluoro-5-isocyano-2,3-dimethyl-2H-benzimidazole.
| Compound Name | (2S)-1-(2,5-dimethylphenyl)-4,6-difluoro-5-isocyano-2,3-dimethyl-2H-benzimidazole |
|---|---|
| PubChem CID | 153430443 |
| Molecular Formula | C18H17F2N3 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (2S)-1-(2,5-dimethylphenyl)-4,6-difluoro-5-isocyano-2,3-dimethyl-2H-benzimidazole |
| SMILES | [C-]#[N+]c1c(F)cc2c(c1F)N(C)[C@H](C)N2c1cc(C)ccc1C |
| InChI | InChI=1S/C18H17F2N3/c1-10-6-7-11(2)14(8-10)23-12(3)22(5)18-15(23)9-13(19)17(21-4)16(18)20/h6-9,12H,1-3,5H3/t12-/m0/s1 |
| InChIKey | NWDZAMYYBVUOEY-LBPRGKRZSA-N |
| XLogP | 5.07 |
| TPSA | 10.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|