C23H19N3O — CID 153430535
(2S)-4-isocyano-1,2-dimethyl-3-(3-methyldibenzofuran-4-yl)-2H-benzimidazole (PubChem CID 153430535) has the molecular formula C23H19N3O and a molecular weight of 353.43 g/mol. Its IUPAC name is (2S)-4-isocyano-1,2-dimethyl-3-(3-methyldibenzofuran-4-yl)-2H-benzimidazole.
| Compound Name | (2S)-4-isocyano-1,2-dimethyl-3-(3-methyldibenzofuran-4-yl)-2H-benzimidazole |
|---|---|
| PubChem CID | 153430535 |
| Molecular Formula | C23H19N3O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (2S)-4-isocyano-1,2-dimethyl-3-(3-methyldibenzofuran-4-yl)-2H-benzimidazole |
| SMILES | [C-]#[N+]c1cccc2c1N(c1c(C)ccc3c1oc1ccccc13)[C@@H](C)N2C |
| InChI | InChI=1S/C23H19N3O/c1-14-12-13-17-16-8-5-6-11-20(16)27-23(17)21(14)26-15(2)25(4)19-10-7-9-18(24-3)22(19)26/h5-13,15H,1-2,4H3/t15-/m0/s1 |
| InChIKey | XWMQUPKTAVQHNL-HNNXBMFYSA-N |
| XLogP | 6.38 |
| TPSA | 23.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|