C29H43F6NO8S2Si — CID 153431202
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-[6-methyl-1-(trifluoromethylsulfonyl)-4-(trifluoromethylsulfonyloxy)-2,3-dihydroindol-5-yl]-2-triethylsilyloxyacetate (PubChem CID 153431202) has the molecular formula C29H43F6NO8S2Si and a molecular weight of 739.87 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-[6-methyl-1-(trifluoromethylsulfonyl)-4-(trifluoromethylsulfonyloxy)-2,3-dihydroindol-5-yl]-2-triethylsilyloxyacetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-[6-methyl-1-(trifluoromethylsulfonyl)-4-(trifluoromethylsulfonyloxy)-2,3-dihydroindol-5-yl]-2-triethylsilyloxyacetate |
|---|---|
| PubChem CID | 153431202 |
| Molecular Formula | C29H43F6NO8S2Si |
| Molecular Weight | 739.87 g/mol |
| Exact Mass | 739.21 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-[6-methyl-1-(trifluoromethylsulfonyl)-4-(trifluoromethylsulfonyloxy)-2,3-dihydroindol-5-yl]-2-triethylsilyloxyacetate |
| SMILES | CC[Si](CC)(CC)O[C@H](C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)c1c(C)cc2c(c1OS(=O)(=O)C(F)(F)F)CCN2S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C29H43F6NO8S2Si/c1-8-47(9-2,10-3)44-26(27(37)42-23-15-18(6)11-12-20(23)17(4)5)24-19(7)16-22-21(25(24)43-46(40,41)29(33,34)35)13-14-36(22)45(38,39)28(30,31)32/h16-18,20,23,26H,8-15H2,1-7H3/t18-,20+,23-,26+/m1/s1 |
| InChIKey | PZUJYSJNVZIMQD-WMZXJIEISA-N |
| XLogP | 7.50 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.87 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|