About (2-oxo-4a,8a-dihydrochromen-3-yl)-diphenylsulfanium
(2-oxo-4a,8a-dihydrochromen-3-yl)-diphenylsulfanium (PubChem CID 153431264) has the molecular formula C21H17O2S+
and a molecular weight of 333.43 g/mol. Its IUPAC name is (2-oxo-4a,8a-dihydrochromen-3-yl)-diphenylsulfanium.
Molecular Properties
| Compound Name | (2-oxo-4a,8a-dihydrochromen-3-yl)-diphenylsulfanium |
| PubChem CID | 153431264 |
| Molecular Formula | C21H17O2S+ |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | (2-oxo-4a,8a-dihydrochromen-3-yl)-diphenylsulfanium |
| SMILES | O=C1OC2C=CC=CC2C=C1[S+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17O2S/c22-21-20(15-16-9-7-8-14-19(16)23-21)24(17-10-3-1-4-11-17)18-12-5-2-6-13-18/h1-16,19H/q+1 |
| InChIKey | DXTYXAHVJQVECU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-4a,8a-dihydrochromen-3-yl)-diphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-4a,8a-dihydrochromen-3-yl)-diphenylsulfanium?
The IUPAC name of (2-oxo-4a,8a-dihydrochromen-3-yl)-diphenylsulfanium (CID 153431264) is (2-oxo-4a,8a-dihydrochromen-3-yl)-diphenylsulfanium.
What is the SMILES notation for (2-oxo-4a,8a-dihydrochromen-3-yl)-diphenylsulfanium?
The canonical SMILES for (2-oxo-4a,8a-dihydrochromen-3-yl)-diphenylsulfanium is O=C1OC2C=CC=CC2C=C1[S+](c1ccccc1)c1ccccc1.
What is the InChIKey of (2-oxo-4a,8a-dihydrochromen-3-yl)-diphenylsulfanium?
The InChIKey is DXTYXAHVJQVECU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17O2S/c22-21-20(15-16-9-7-8-14-19(16)23-21)24(17-10-3-1-4-11-17)18-12-5-2-6-13-18/h1-16,19H/q+1.
What are the key properties of (2-oxo-4a,8a-dihydrochromen-3-yl)-diphenylsulfanium?
(2-oxo-4a,8a-dihydrochromen-3-yl)-diphenylsulfanium has a molecular weight of 333.43 g/mol, XLogP of 4.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-4a,8a-dihydrochromen-3-yl)-diphenylsulfanium is sourced from PubChem (CID 153431264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).